chandrekha608
chandrekha608 chandrekha608
  • 25-07-2021
  • Social Studies
contestada

why is nepal still lagging behind in developnment​

Relax

Respuesta :

horizonf7 horizonf7
  • 25-07-2021
Nepal still behind a lot of things and it’s very new to things
Answer Link

Otras preguntas

____________ is one of the state’s main responsibilities to public education? a. Setting general school standards c. Hiring quality teachers b. Setting conseque
Describe how to use Le Chatelier’s principle to predict the possible ways a chemical system can respond to changes.
Which of the following would be used to measure the amount of matter in an object? Weight Density Mass Gravity
What were some of the ideas expressed by Hitler in mein kampf
what are some positives and negatives on loose contructionism
What is the concentration of 10.00 mL of HBr if it takes 16.73 mL of a 0.253 M LiOH solution to neutralize it?
Profit is the difference between revenue and cost. The revenue, in dollars, of a company that manufactures cell phones can be modeled by the polynomial 2x2 + 55
what is the degree of the monomial 3xto the 2nd power y to the 3rd power
Which modifier correctly completes the sentence? allen knows how to speak very __________ in public. a. good b. well?
Blance this out please! Ba(CN)2+2H2SO4=BaSO4+2HCN